BlueBrainBoost
freedom-pharmacy
Purchases through the above links give commission which helps fund this website

Cianidanol

(2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol

SMILES: C1[C@@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O

InChIKey: PFTAWBLQPZVEMU-DZGCQCFKSA-N

Pharmaceutical compound structure

Synonyms: (+)-catechin, Cianidanol, CATECHIN, 154-23-4, Catechuic acid

Classification: Miscellaneous

Action: Various

Ref Target proteins for various compounds