BlueBrainBoost
freedom-pharmacy
Purchases through the above links give commission which helps fund this website

AM-905

(6aR,9R,10aR)-3-[(E)-hept-1-enyl]-9-(hydroxymethyl)-6,6-dimethyl-6a,7,8,9,10,10a-hexahydrobenzo[c]chromen-1-ol

SMILES: CCCCC/C=C/C1=CC2=C([C@@H]3C[C@@H](CC[C@H]3C(O2)(C)C)CO)C(=C1)O

InChIKey: NJIKRWBGUIYKJM-OKMMTOMJSA-N

Pharmaceutical compound structure

Synonyms: UNII-TJ6JD73J07, CHEMBL127848, TJ6JD73J07, AM-905, BDBM50053266

Classification: Miscellaneous

Action: Various

Mechanism: Cannabinoid receptor modulator

Ref Target proteins for various compounds