BlueBrainBoost
freedom-pharmacy
Purchases through the above links give commission which helps fund this website

AM-411

(6aR,10aR)-3-(1-adamantyl)-6,6,9-trimethyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol

SMILES: CC1=CC[C@@H]2[C@@H](C1)C3=C(C=C(C=C3O)C45CC6CC(C4)CC(C6)C5)OC2(C)C

InChIKey: RPBMPWGKZFLMFN-OKFSJJLXSA-N

Pharmaceutical compound structure

Synonyms: AM-411, CHEMBL434351, D09CKZ, BDBM50169951, (6aR,10aR)-3-Adamantan-1-yl-6,6,9-trimethyl-6a,7,10,10a-tetrahydro-6H-benzo[c...

Classification: Miscellaneous

Action: Various

Mechanism: Cannabinoid receptor modulator

Ref Target proteins for various compounds